EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31991 - phenol red
| Formula | C19H14O5S |
| Net Charge | 0 |
| Average Mass | 354.383 |
| Monoisotopic Mass | 354.05619 |
| SMILES | O=S1(=O)OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H14O5S/c20-15-9-5-13(6-10-15)19(14-7-11-16(21)12-8-14)17-3-1-2-4-18(17)25(22,23)24-19/h1-12,20-21H |
| InChIKey | BELBBZDIHDAJOR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. two-colour indicator A colour indicator that possesses a different colour on each side of the transition interval. acid-base indicator An acid or base which exhibits a colour change on neutralization by the basic or acidic titrant at or near the equivalence point of a titration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenol red (CHEBI:31991) has role acid-base indicator (CHEBI:50407) |
| phenol red (CHEBI:31991) has role diagnostic agent (CHEBI:33295) |
| phenol red (CHEBI:31991) has role two-colour indicator (CHEBI:50412) |
| phenol red (CHEBI:31991) is a 2,1-benzoxathiole (CHEBI:38087) |
| phenol red (CHEBI:31991) is a arenesulfonate ester (CHEBI:38094) |
| phenol red (CHEBI:31991) is a phenols (CHEBI:33853) |
| phenol red (CHEBI:31991) is a sultone (CHEBI:38088) |
| IUPAC Name |
|---|
| 4,4'-(1,1-dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol |
| Synonyms | Source |
|---|---|
| 3,3-bis(p-hydroxyphenyl)-3H-2,1-benzoxathiole 1,1-dioxide | ChEBI |
| 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bisphenol S,S-dioxide | ChemIDplus |
| Phenol red | KEGG COMPOUND |
| Phenolsulfonphthalein | KEGG COMPOUND |
| PSP | ChemIDplus |
| α-hydroxy-α,α-bis(p-hydroxyphenyl)-o-toluenesulfonic acid γ-sultone | ChEBI |