EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O2 |
| Net Charge | 0 |
| Average Mass | 206.245 |
| Monoisotopic Mass | 206.10553 |
| SMILES | CCC(C(=O)NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O2/c1-2-9(10(14)13-11(12)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H3,12,13,14,15) |
| InChIKey | AJOQSQHYDOFIOX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pheneturide (CHEBI:31989) has role anticonvulsant (CHEBI:35623) |
| Pheneturide (CHEBI:31989) is a amine (CHEBI:32952) |
| INN | Source |
|---|---|
| feneturida | WHO MedNet |
| Synonyms | Source |
|---|---|
| Benuride | ChEMBL |
| Dl-pheneturide | ChEMBL |
| ethyl phenacemide | DrugCentral |
| Ethylphenacemide | KEGG COMPOUND |
| ethylphenylacetylurea | DrugCentral |
| Lircapyl | ChEMBL |
| Brand Name | Source |
|---|---|
| Laburide | ChEMBL |
| Citations |
|---|