EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3OS |
| Net Charge | 0 |
| Average Mass | 365.502 |
| Monoisotopic Mass | 365.15618 |
| SMILES | N#Cc1ccc2c(c1)N(CCCN1CCC(O)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C21H23N3OS/c22-15-16-6-7-21-19(14-16)24(18-4-1-2-5-20(18)26-21)11-3-10-23-12-8-17(25)9-13-23/h1-2,4-7,14,17,25H,3,8-13H2 |
| InChIKey | LUALIOATIOESLM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| Applications: | first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| periciazine (CHEBI:31981) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| periciazine (CHEBI:31981) has role adrenergic antagonist (CHEBI:37887) |
| periciazine (CHEBI:31981) has role first generation antipsychotic (CHEBI:65190) |
| periciazine (CHEBI:31981) has role sedative (CHEBI:35717) |
| periciazine (CHEBI:31981) is a hydroxypiperidine (CHEBI:48590) |
| periciazine (CHEBI:31981) is a nitrile (CHEBI:18379) |
| periciazine (CHEBI:31981) is a phenothiazines (CHEBI:38093) |
| IUPAC Name |
|---|
| 10-[3-(4-hydroxypiperidin-1-yl)propyl]-10H-phenothiazine-2-carbonitrile |
| INNs | Source |
|---|---|
| periciazine | WHO MedNet |
| periciazinum | WHO MedNet |
| périciazine | WHO MedNet |
| periciazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 10-(3-(4-Hydroxypiperidino)propyl)phenothiazine-2-carbonitrile | ChemIDplus |
| 2-Cyano-10-(3-(4-hydroxy-1-piperidyl)propyl)phenothiazine | ChemIDplus |
| 2-Cyano-10-(3-(4-hydroxypiperidino)propyl)phenothiazine | ChemIDplus |
| Cyano-3 ((hydroxy-4 piperidyl-1)-3 propyl)-10 phenothiazine | ChemIDplus |
| Piperocyanomazine | ChemIDplus |
| Propericiazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01485 | KEGG DRUG |
| FR1212031 | Patent |
| DB01608 | DrugBank |
| HMDB0015546 | HMDB |
| Periciazine | Wikipedia |
| LSM-24971 | LINCS |
| 2107 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:576739 | Reaxys |
| CAS:2622-26-6 | ChemIDplus |
| Citations |
|---|