EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29N3O2 |
| Net Charge | 0 |
| Average Mass | 379.504 |
| Monoisotopic Mass | 379.22598 |
| SMILES | COc1cc2nc(C)c(CCN3CCN(c4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C23H29N3O2/c1-17-19(20-15-22(27-2)23(28-3)16-21(20)24-17)9-10-25-11-13-26(14-12-25)18-7-5-4-6-8-18/h4-8,15-16,24H,9-14H2,1-3H3 |
| InChIKey | XCWPUUGSGHNIDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxypertine (CHEBI:31952) has role antipsychotic agent (CHEBI:35476) |
| Oxypertine (CHEBI:31952) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| oxipertina | WHO MedNet |
| Synonyms | Source |
|---|---|
| equipertine | DrugCentral |
| Integrin (flavone) | ChEMBL |
| Oxipertine | ChEMBL |
| oxypertin | DrugCentral |
| Oxypertine | KEGG COMPOUND |
| WIN 18,501-2 | ChEMBL |
| Brand Names | Source |
|---|---|
| Forit | ChEMBL |
| Integrin | ChEMBL |
| Citations |
|---|