EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N4O |
| Net Charge | 0 |
| Average Mass | 426.564 |
| Monoisotopic Mass | 426.24196 |
| SMILES | O=c1nc2ccccc2n1CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N4O/c32-27-28-24-14-7-8-15-25(24)31(27)17-9-16-29-18-20-30(21-19-29)26(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-8,10-15,26H,9,16-21H2,(H,28,32) |
| InChIKey | BAINIUMDFURPJM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. anti-allergic agent A drug used to treat allergic reactions. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anti-inflammatory agent Any compound that has anti-inflammatory effects. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxatomide (CHEBI:31943) has role anti-allergic agent (CHEBI:50857) |
| oxatomide (CHEBI:31943) has role anti-inflammatory agent (CHEBI:67079) |
| oxatomide (CHEBI:31943) has role geroprotector (CHEBI:176497) |
| oxatomide (CHEBI:31943) has role H1-receptor antagonist (CHEBI:37955) |
| oxatomide (CHEBI:31943) has role serotonergic antagonist (CHEBI:48279) |
| oxatomide (CHEBI:31943) is a N-alkylpiperazine (CHEBI:46845) |
| oxatomide (CHEBI:31943) is a benzimidazoles (CHEBI:22715) |
| oxatomide (CHEBI:31943) is a diarylmethane (CHEBI:51614) |
| IUPAC Name |
|---|
| 1-{3-[4-(diphenylmethyl)piperazin-1-yl]propyl}-1,3-dihydro-2H-benzimidazol-2-one |
| INNs | Source |
|---|---|
| oxatomide | WHO MedNet |
| oxatomide | WHO MedNet |
| oxatomidum | WHO MedNet |
| oxatomida | WHO MedNet |
| Synonyms | Source |
|---|---|
| KW-4354 | ChemIDplus |
| R 35 443 | DrugCentral |
| R 35,443 | ChemIDplus |
| R 35443 | ChemIDplus |
| 1-[3-[4-(diphenylmethyl)-1-piperazinyl]propyl]-1,3-dihydro-2H-benzimidazol-2-one | ChEBI |
| Brand Names | Source |
|---|---|
| Celtomide | DrugCentral |
| Celtect | KEGG DRUG |
| Tinset | ChemIDplus |
| Cenacert | ChEBI |
| Cobiona | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4724760 | Reaxys |
| CAS:60607-34-3 | ChemIDplus |
| CAS:60607-34-3 | NIST Chemistry WebBook |
| Citations |
|---|