EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N4O |
| Net Charge | 0 |
| Average Mass | 426.564 |
| Monoisotopic Mass | 426.24196 |
| SMILES | O=c1nc2ccccc2n1CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N4O/c32-27-28-24-14-7-8-15-25(24)31(27)17-9-16-29-18-20-30(21-19-29)26(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-8,10-15,26H,9,16-21H2,(H,28,32) |
| InChIKey | BAINIUMDFURPJM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-allergic agent A drug used to treat allergic reactions. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxatomide (CHEBI:31943) has role anti-allergic agent (CHEBI:50857) |
| oxatomide (CHEBI:31943) has role anti-inflammatory agent (CHEBI:67079) |
| oxatomide (CHEBI:31943) has role geroprotector (CHEBI:176497) |
| oxatomide (CHEBI:31943) has role H1-receptor antagonist (CHEBI:37955) |
| oxatomide (CHEBI:31943) has role serotonergic antagonist (CHEBI:48279) |
| oxatomide (CHEBI:31943) is a N-alkylpiperazine (CHEBI:46845) |
| oxatomide (CHEBI:31943) is a benzimidazoles (CHEBI:22715) |
| oxatomide (CHEBI:31943) is a diarylmethane (CHEBI:51614) |
| IUPAC Name |
|---|
| 1-{3-[4-(diphenylmethyl)piperazin-1-yl]propyl}-1,3-dihydro-2H-benzimidazol-2-one |
| INNs | Source |
|---|---|
| oxatomida | WHO MedNet |
| oxatomide | WHO MedNet |
| oxatomide | WHO MedNet |
| oxatomidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[3-[4-(diphenylmethyl)-1-piperazinyl]propyl]-1,3-dihydro-2H-benzimidazol-2-one | ChEBI |
| KW-4354 | ChemIDplus |
| R 35 443 | DrugCentral |
| R 35,443 | ChemIDplus |
| R 35443 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Celtect | KEGG DRUG |
| Celtomide | DrugCentral |
| Cenacert | ChEBI |
| Cobiona | ChEBI |
| Tinset | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4724760 | Reaxys |
| CAS:60607-34-3 | ChemIDplus |
| CAS:60607-34-3 | NIST Chemistry WebBook |
| Citations |
|---|