EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O4Pt |
| Net Charge | 0 |
| Average Mass | 397.288 |
| Monoisotopic Mass | 397.06015 |
| SMILES | [H][N]1([H])[C@@H]2CCCC[C@H]2[N]([H])([H])[Pt]12[O]C(=O)C(=O)[O]2 |
| InChI | InChI=1S/C6H14N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-6H,1-4,7-8H2;(H,3,4)(H,5,6);/q;;+2/p-2/t5-,6-;;/m1../s1 |
| InChIKey | ZROHGHOFXNOHSO-BNTLRKBRSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxaliplatin (CHEBI:31941) has role antineoplastic agent (CHEBI:35610) |
| oxaliplatin (CHEBI:31941) has role mutagen (CHEBI:25435) |
| oxaliplatin (CHEBI:31941) is a platinum coordination entity (CHEBI:33862) |
| Incoming Relation(s) |
| cucurbit[7]uril—oxaliplatin (CHEBI:51436) has part oxaliplatin (CHEBI:31941) |
| IUPAC Name |
|---|
| (SP-4-2)[(1R,2R)-cyclohexane-1,2-diamine-κ2N,N'][ethanedioato(2−)-κ2O1,O2]platinum |
| INNs | Source |
|---|---|
| oxaliplatin | KEGG DRUG |
| oxaliplatine | ChEBI |
| oxaliplatino | DrugBank |
| oxaliplatinum | DrugBank |
| Synonyms | Source |
|---|---|
| (SP-4-2-(1R-trans))-(1,2-cyclohexanediamine-N,N')(ethanedioato(2−)-O,O')platinum | ChemIDplus |
| oxalato(1,2-diaminocyclohexane)platinum(II) | ChemIDplus |
| Oxaliplatin | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Eloxatin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01790 | KEGG DRUG |
| DB00526 | DrugBank |
| LSM-6352 | LINCS |
| Oxaliplatin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1046012 | Gmelin |
| Reaxys:15700099 | Reaxys |
| Gmelin:28892 | Gmelin |
| CAS:61825-94-3 | KEGG COMPOUND |
| CAS:63121-00-6 | ChemIDplus |
| Citations |
|---|