EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO3 |
| Net Charge | 0 |
| Average Mass | 229.235 |
| Monoisotopic Mass | 229.07389 |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccccc1O |
| InChI | InChI=1S/C13H11NO3/c15-10-7-5-9(6-8-10)14-13(17)11-3-1-2-4-12(11)16/h1-8,15-16H,(H,14,17) |
| InChIKey | LGCMKPRGGJRYGM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Osalmid (CHEBI:31938) has role antineoplastic agent (CHEBI:35610) |
| Osalmid (CHEBI:31938) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| osalmida | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-1718 | ChEMBL |
| NSC-93960 | ChEMBL |
| oksafenamide | DrugCentral |
| Osalmid | KEGG COMPOUND |
| osalmide | DrugCentral |
| oxaphenamid | DrugCentral |
| Citations |
|---|