EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31935 - Omoconazole nitrate
| Formula | C20H17Cl3N2O2.HNO3 |
| Net Charge | 0 |
| Average Mass | 486.739 |
| Monoisotopic Mass | 485.03120 |
| SMILES | C/C(=C(/OCCOc1ccc(Cl)cc1)c1ccc(Cl)cc1Cl)n1ccnc1.O=[N+]([O-])O |
| InChI | InChI=1S/C20H17Cl3N2O2.HNO3/c1-14(25-9-8-24-13-25)20(18-7-4-16(22)12-19(18)23)27-11-10-26-17-5-2-15(21)3-6-17;2-1(3)4/h2-9,12-13H,10-11H2,1H3;(H,2,3,4)/b20-14-; |
| InChIKey | BNDOPUYTWJQTOE-VSOKSMTPSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Omoconazole nitrate (CHEBI:31935) is a conazole antifungal drug (CHEBI:87071) |
| Omoconazole nitrate (CHEBI:31935) is a imidazole antifungal drug (CHEBI:87069) |
| Omoconazole nitrate (CHEBI:31935) is a organic nitrate salt (CHEBI:51085) |
| Synonyms | Source |
|---|---|
| Omoconazole nitrate | KEGG COMPOUND |
| 1-[2-[2-(4-chlorophenoxy)ethoxy]-2-(2,4-dichlorophenyl)-1-methyl-vinyl]-1H-imidazole nitric acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01664 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:83621-06-1 | KEGG COMPOUND |