EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H35N2O11.Na |
| Net Charge | 0 |
| Average Mass | 634.614 |
| Monoisotopic Mass | 634.21385 |
| SMILES | CO[C@@H]1[C@@H](OC(N)=O)[C@@H](O)[C@H](Oc2ccc3c([O-])c(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2C)OC1(C)C.[Na+] |
| InChI | InChI=1S/C31H36N2O11.Na/c1-14(2)7-8-16-13-17(9-11-19(16)34)27(37)33-21-22(35)18-10-12-20(15(3)24(18)42-28(21)38)41-29-23(36)25(43-30(32)39)26(40-6)31(4,5)44-29;/h7,9-13,23,25-26,29,34-36H,8H2,1-6H3,(H2,32,39)(H,33,37);/q;+1/p-1/t23-,25+,26-,29-;/m1./s1 |
| InChIKey | WWPRGAYLRGSOSU-RNROJPEYSA-M |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Novobiocin sodium (CHEBI:31924) has role antineoplastic agent (CHEBI:35610) |
| Novobiocin sodium (CHEBI:31924) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Novobiocin monosodium salt | ChEMBL |
| Novobiocin, monosodium salt | ChEMBL |
| Novobiocin sodium | KEGG COMPOUND |
| NSC-2382 | ChEMBL |
| Sodium novobiocin | ChEMBL |
| Brand Names | Source |
|---|---|
| Spheromycin | ChEMBL |
| Vulcamycin | ChEMBL |
| Citations |
|---|