EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15NO4 |
| Net Charge | 0 |
| Average Mass | 333.343 |
| Monoisotopic Mass | 333.10011 |
| SMILES | COc1ccc2c(cnc3c4cc5c(cc4ccc23)OCO5)c1OC |
| InChI | InChI=1S/C20H15NO4/c1-22-16-6-5-12-13-4-3-11-7-17-18(25-10-24-17)8-14(11)19(13)21-9-15(12)20(16)23-2/h3-9H,10H2,1-2H3 |
| InChIKey | JGUNQXPMULKFNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Norchelerythrine (CHEBI:31917) is a benzophenanthridine alkaloid (CHEBI:38517) |
| Synonym | Source |
|---|---|
| Norchelerythrine | KEGG COMPOUND |