EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O8 |
| Net Charge | 0 |
| Average Mass | 382.324 |
| Monoisotopic Mass | 382.06887 |
| SMILES | CC(=O)CC(=O)c1c(CC(=O)O)cc2c(c1O)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C20H14O8/c1-8(21)5-13(23)15-9(7-14(24)25)6-11-17(19(15)27)20(28)16-10(18(11)26)3-2-4-12(16)22/h2-4,6,22,27H,5,7H2,1H3,(H,24,25) |
| InChIKey | WTOVDVFGOSWBFR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces nogalater (ncbitaxon:38314) | - | PubMed (20052967) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nogalonic acid (CHEBI:31915) has role bacterial metabolite (CHEBI:76969) |
| nogalonic acid (CHEBI:31915) is a dihydroxyanthraquinone (CHEBI:37484) |
| nogalonic acid (CHEBI:31915) is a oxo monocarboxylic acid (CHEBI:35871) |
| nogalonic acid (CHEBI:31915) is a polyketide (CHEBI:26188) |
| nogalonic acid (CHEBI:31915) is a polyphenol (CHEBI:26195) |
| nogalonic acid (CHEBI:31915) is conjugate acid of nogalonate(2−) (CHEBI:84897) |
| Incoming Relation(s) |
| methyl nogalonate (CHEBI:85142) has functional parent nogalonic acid (CHEBI:31915) |
| nogalonate(2−) (CHEBI:84897) is conjugate base of nogalonic acid (CHEBI:31915) |
| IUPAC Name |
|---|
| [4,5-dihydroxy-9,10-dioxo-3-(3-oxobutanoyl)-9,10-dihydroanthracen-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| C12416 | KEGG COMPOUND |
| Citations |
|---|