EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9N3O4 |
| Net Charge | 0 |
| Average Mass | 211.177 |
| Monoisotopic Mass | 211.05931 |
| SMILES | O=C(NCCO[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C8H9N3O4/c12-8(7-2-1-3-9-6-7)10-4-5-15-11(13)14/h1-3,6H,4-5H2,(H,10,12) |
| InChIKey | LBHIOVVIQHSOQN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | potassium channel opener A potassium channel modulator that opens the potassium channel. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicorandil (CHEBI:31905) has functional parent nicotinamide (CHEBI:17154) |
| nicorandil (CHEBI:31905) has role potassium channel opener (CHEBI:79085) |
| nicorandil (CHEBI:31905) has role vasodilator agent (CHEBI:35620) |
| nicorandil (CHEBI:31905) is a nitrate ester (CHEBI:51080) |
| nicorandil (CHEBI:31905) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| 2-[(pyridin-3-ylcarbonyl)amino]ethyl nitrate |
| INNs | Source |
|---|---|
| nicorandil | WHO MedNet |
| nicorandil | WHO MedNet |
| nicorandil | WHO MedNet |
| nicorandilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-nicotinamidoethyl nitrate | ChemIDplus |
| N-(2-hydroxyethyl)nicotinamide nitrate | ChemIDplus |
| SG 75 | ChemIDplus |
| SG-75 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Adancor | ChEBI |
| Ikorel | ChEBI |
| Perisalol | ChEBI |
| Sigmart | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:65141-46-0 | ChemIDplus |
| CAS:65141-46-0 | KEGG COMPOUND |
| Citations |
|---|