EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H24N4O8 |
| Net Charge | 0 |
| Average Mass | 556.531 |
| Monoisotopic Mass | 556.15941 |
| SMILES | O=C(OCC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C29H24N4O8/c34-25(21-5-1-9-30-13-21)38-17-29(18-39-26(35)22-6-2-10-31-14-22,19-40-27(36)23-7-3-11-32-15-23)20-41-28(37)24-8-4-12-33-16-24/h1-16H,17-20H2 |
| InChIKey | KUEUWHJGRZKESU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Niceritrol (CHEBI:31903) has role cardiovascular drug (CHEBI:35554) |
| Niceritrol (CHEBI:31903) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Niceritrol | KEGG COMPOUND |
| niceritrol tetrahydrochloride | DrugCentral |
| nicotinic acid neopentanetetrayl ester | DrugCentral |
| Pentaerithritol tetranicotinate | ChEMBL |
| pentaerythritol tetranicotinate | DrugCentral |
| pentaerythritoltetranicotinate | DrugCentral |
| Citations |
|---|