EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26BrN3O3 |
| Net Charge | 0 |
| Average Mass | 484.394 |
| Monoisotopic Mass | 483.11575 |
| SMILES | [H][C@@]12Cc3cn(C)c4cccc(c34)[C@@]1(OC)C[C@@H](COC(=O)c1cncc(Br)c1)CN2C |
| InChI | InChI=1S/C24H26BrN3O3/c1-27-13-17-8-21-24(30-3,19-5-4-6-20(27)22(17)19)9-15(12-28(21)2)14-31-23(29)16-7-18(25)11-26-10-16/h4-7,10-11,13,15,21H,8-9,12,14H2,1-3H3/t15-,21-,24+/m1/s1 |
| InChIKey | YSEXMKHXIOCEJA-FVFQAYNVSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nicergoline (CHEBI:31902) has role antidepressant (CHEBI:35469) |
| Nicergoline (CHEBI:31902) has role antipsychotic agent (CHEBI:35476) |
| Nicergoline (CHEBI:31902) has role anxiolytic drug (CHEBI:35474) |
| Nicergoline (CHEBI:31902) has role cardiovascular drug (CHEBI:35554) |
| Nicergoline (CHEBI:31902) is a organic heterotetracyclic compound (CHEBI:38163) |
| Nicergoline (CHEBI:31902) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| INN | Source |
|---|---|
| nicergolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 10-methoxy-1,6-dimethylergoline-8β-methanol 5-bromonicotinate | ChemIDplus |
| (8β)-10-methoxy-1,6-dimethylergoline-8-methanol 5-bromo-3-pyridinecarboxylate (ester) | ChemIDplus |
| cergodum | DrugCentral |
| Circo-maren | ChEMBL |
| Dilasenil | ChEMBL |
| duracebrol | DrugCentral |
| Brand Name | Source |
|---|---|
| Sermion | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1910 | DrugCentral |
| D01290 | KEGG DRUG |
| HMDB0014837 | HMDB |
| LSM-3720 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:903548 | Beilstein |
| CAS:27848-84-6 | KEGG COMPOUND |
| CAS:27848-84-6 | ChemIDplus |
| Citations |
|---|