EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O2.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 414.411 |
| Monoisotopic Mass | 414.16383 |
| SMILES | CCN(CC)CCOC(=O)c1cccnc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18N2O2.C6H8O7/c1-3-14(4-2)8-9-16-12(15)11-6-5-7-13-10-11;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-7,10H,3-4,8-9H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | IABBAGAOMDWOCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nicametate citrate (CHEBI:31901) is a aromatic carboxylic acid (CHEBI:33859) |
| Nicametate citrate (CHEBI:31901) is a pyridines (CHEBI:26421) |
| Synonym | Source |
|---|---|
| Nicametate citrate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01232 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:1641-74-3 | KEGG COMPOUND |