EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2OS.HCl |
| Net Charge | 0 |
| Average Mass | 338.904 |
| Monoisotopic Mass | 338.12196 |
| SMILES | CCCCCOc1ccccc1/C(=C\SC)n1ccnc1.Cl |
| InChI | InChI=1S/C17H22N2OS.ClH/c1-3-4-7-12-20-17-9-6-5-8-15(17)16(13-21-2)19-11-10-18-14-19;/h5-6,8-11,13-14H,3-4,7,12H2,1-2H3;1H/b16-13+; |
| InChIKey | HAHMABKERDVYCH-ZUQRMPMESA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neticonazole hydrochloride (CHEBI:31900) has part neticonazole(1+) (CHEBI:141384) |
| neticonazole hydrochloride (CHEBI:31900) has role antifungal drug (CHEBI:86327) |
| neticonazole hydrochloride (CHEBI:31900) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| neticonazole hydrochloride (CHEBI:31900) is a conazole antifungal drug (CHEBI:87071) |
| neticonazole hydrochloride (CHEBI:31900) is a hydrochloride (CHEBI:36807) |
| neticonazole hydrochloride (CHEBI:31900) is a imidazole antifungal drug (CHEBI:87069) |
| IUPAC Names |
|---|
| 1-{(E)-2-(methylthio)-1-[2-(pentyloxy)phenyl]vinyl}-1H-imidazol-3-ium chloride |
| 1-{(E)-2-(methylthio)-1-[2-(pentyloxy)phenyl]vinyl}-1H-imidazole hydrochloride |
| Synonyms | Source |
|---|---|
| 1-{(E)-2-(methylsulfanyl)-1-[2-(pentyloxy)phenyl]vinyl}-1H-imidazol-3-ium chloride | IUPAC |
| 1-{(E)-2-(methylsulfanyl)-1-[2-(pentyloxy)phenyl]vinyl}-1H-imidazole hydrochloride | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5366849 | Reaxys |
| CAS:130773-02-3 | ChemIDplus |
| Citations |
|---|