EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H8N2O3Pt |
| Net Charge | 0 |
| Average Mass | 303.175 |
| Monoisotopic Mass | 303.01828 |
| SMILES | [H][N]([H])([H])[Pt]1([N]([H])([H])[H])[O]CC(=O)[O]1 |
| InChI | InChI=1S/C2H3O3.2H3N.Pt/c3-1-2(4)5;;;/h1H2,(H,4,5);2*1H3;/q-1;;;+2/p-1 |
| InChIKey | GYAVMUDJCHAASE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nedaplatin (CHEBI:31898) has role antineoplastic agent (CHEBI:35610) |
| nedaplatin (CHEBI:31898) is a platinum coordination entity (CHEBI:33862) |
| IUPAC Name |
|---|
| (SP-4-3)-diammine[(hydroxy-κO)acetato(2−)-κO]platinum |
| INNs | Source |
|---|---|
| nedaplatine | WHO MedNet |
| nedaplatino | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aqupla | ChEMBL |
| Cis-diammine-glycolatoplatinum | ChEMBL |
| (glycolato-O,O')diammineplatinum(II) | ChemIDplus |
| cis-diammine(glycolato)platinum | ChemIDplus |
| cis-diammine(glycolato)platinum(II) | ChemIDplus |
| Nedaplatin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:95734-82-0 | KEGG COMPOUND |
| CAS:95734-82-0 | ChemIDplus |
| Citations |
|---|