EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31892 - naloxone hydrochloride
| Formula | C19H21NO4.HCl |
| Net Charge | 0 |
| Average Mass | 363.841 |
| Monoisotopic Mass | 363.12374 |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5.Cl |
| InChI | InChI=1S/C19H21NO4.ClH/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11;/h2-4,14,17,21,23H,1,5-10H2;1H/t14-,17+,18+,19-;/m1./s1 |
| InChIKey | RGPDIGOSVORSAK-STHHAXOLSA-N |
| Roles Classification |
|---|
| Biological Role: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor |
| Applications: | antidote to opioid poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of opioids. mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naloxone hydrochloride (CHEBI:31892) has part naloxone(1+) (CHEBI:90756) |
| naloxone hydrochloride (CHEBI:31892) has role antidote to opioid poisoning (CHEBI:90755) |
| naloxone hydrochloride (CHEBI:31892) has role central nervous system depressant (CHEBI:35488) |
| naloxone hydrochloride (CHEBI:31892) has role μ-opioid receptor antagonist (CHEBI:50137) |
| naloxone hydrochloride (CHEBI:31892) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 17-allyl-3,14-dihydroxy-4,5α-epoxymorphinan-6-one hydrochloride |
| Synonyms | Source |
|---|---|
| (5α)-17-allyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one hydrochloride | IUPAC |
| (5α,17R)-17-allyl-3,14-dihydroxy-6-oxo-4,5-epoxymorphinan-17-ium chloride | IUPAC |
| (17R)-17-allyl-3,14-dihydroxy-6-oxo-4,5α-epoxymorphinan-17-ium chloride | IUPAC |
| Brand Name | Source |
|---|---|
| Narcan | KEGG DRUG |
| Citations |
|---|