EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO5 |
| Net Charge | 0 |
| Average Mass | 203.194 |
| Monoisotopic Mass | 203.07937 |
| SMILES | CC(=O)N[C@@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13NO5/c1-5(10)9-6(8(13)14)3-2-4-7(11)12/h6H,2-4H2,1H3,(H,9,10)(H,11,12)(H,13,14)/t6-/m0/s1 |
| InChIKey | FTTGAAZKBNZDCZ-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS20) | ||
| - | DOI (10.1371/journal.pone.0115359) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-2-aminoadipic acid (CHEBI:31885) has role human metabolite (CHEBI:77746) |
| N-acetyl-L-2-aminoadipic acid (CHEBI:31885) is a N-acyl-L-amino acid (CHEBI:21644) |
| N-acetyl-L-2-aminoadipic acid (CHEBI:31885) is conjugate acid of N-acetyl-L-2-aminoadipate(2−) (CHEBI:61509) |
| Incoming Relation(s) |
| N-acetyl-L-2-aminoadipate(2−) (CHEBI:61509) is conjugate base of N-acetyl-L-2-aminoadipic acid (CHEBI:31885) |
| IUPAC Name |
|---|
| (2S)-2-acetamidohexanedioic acid |
| Synonym | Source |
|---|---|
| N2-Acetyl-L-aminoadipate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12986 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21132196 | Reaxys |
| Citations |
|---|