EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | CN[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-6-3(5(9)10)2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChIKey | HOKKHZGPKSLGJE-GSVOUGTGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-D-aspartic acid (CHEBI:31882) has role antidepressant (CHEBI:35469) |
| N-methyl-D-aspartic acid (CHEBI:31882) has role neuroprotective agent (CHEBI:63726) |
| N-methyl-D-aspartic acid (CHEBI:31882) has role neurotransmitter agent (CHEBI:35942) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a D-aspartic acid derivative (CHEBI:83979) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a D-α-amino acid (CHEBI:16733) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a amino dicarboxylic acid (CHEBI:36164) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-methyl-D-aspartic acid |
| Synonyms | Source |
|---|---|
| 2-Methylamino-succinic acid | ChEMBL |
| Methyl aspartic acid | ChemIDplus |
| NMDA | KEGG COMPOUND |
| N-Methylaspartate | ChemIDplus |
| N-Methyl aspartic acid | ChemIDplus |
| N-methyl-daspartate | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C12269 | KEGG COMPOUND |
| CPD-10705 | MetaCyc |
| HMDB0002393 | HMDB |
| N-Methyl-D-aspartic_acid | Wikipedia |
| OEM | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724431 | Reaxys |
| CAS:6384-92-5 | ChemIDplus |
| Citations |
|---|