EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31882 - N-methyl-D-aspartic acid
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | CN[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-6-3(5(9)10)2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChIKey | HOKKHZGPKSLGJE-GSVOUGTGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| Application: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-D-aspartic acid (CHEBI:31882) has role neurotransmitter agent (CHEBI:35942) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a D-aspartic acid derivative (CHEBI:83979) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a D-α-amino acid (CHEBI:16733) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a amino dicarboxylic acid (CHEBI:36164) |
| N-methyl-D-aspartic acid (CHEBI:31882) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-methyl-D-aspartic acid |
| Synonyms | Source |
|---|---|
| 2-Methylamino-succinic acid | ChEMBL |
| Methyl aspartic acid | ChemIDplus |
| NMDA | KEGG COMPOUND |
| N-Methylaspartate | ChemIDplus |
| N-Methyl aspartic acid | ChemIDplus |
| N-Methyl-D-aspartate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12269 | KEGG COMPOUND |
| CPD-10705 | MetaCyc |
| HMDB0002393 | HMDB |
| N-Methyl-D-aspartic_acid | Wikipedia |
| OEM | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724431 | Reaxys |
| CAS:6384-92-5 | ChemIDplus |
| Citations |
|---|