EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35ClN4O.2HCl |
| Net Charge | 0 |
| Average Mass | 551.990 |
| Monoisotopic Mass | 550.20329 |
| SMILES | Cl.Cl.O=C1NC2CCCCN2C12CCN(CCCN1c3ccccc3CCc3ccc(Cl)cc31)CC2 |
| InChI | InChI=1S/C28H35ClN4O.2ClH/c29-23-12-11-22-10-9-21-6-1-2-7-24(21)32(25(22)20-23)16-5-15-31-18-13-28(14-19-31)27(34)30-26-8-3-4-17-33(26)28;;/h1-2,6-7,11-12,20,26H,3-5,8-10,13-19H2,(H,30,34);2*1H |
| InChIKey | CVCDAZZJQWLXHM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mosapramine dihydrochloride (CHEBI:31866) has role dopaminergic antagonist (CHEBI:48561) |
| mosapramine dihydrochloride (CHEBI:31866) has role second generation antipsychotic (CHEBI:65191) |
| mosapramine dihydrochloride (CHEBI:31866) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| rac-1'-[3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)propyl]hexahydro-2H-spiro[imidazo[1,2-a]pyridine-3,4'-piperidin]-2-one dihydrochloride |
| Synonyms | Source |
|---|---|
| Cremin | KEGG DRUG |
| mosapramine .2HCl | ChEBI |
| mosapramine dihydrochloride | KEGG DRUG |
| mosapramine hydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01548 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:98043-60-8 | ChemIDplus |
| Citations |
|---|