EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O4 |
| Net Charge | 0 |
| Average Mass | 242.235 |
| Monoisotopic Mass | 242.10150 |
| SMILES | CCOC(=O)[N-]c1c[n+](N2CCOCC2)no1 |
| InChI | InChI=1S/C9H14N4O4/c1-2-16-9(14)10-8-7-13(11-17-8)12-3-5-15-6-4-12/h7H,2-6H2,1H3 |
| InChIKey | XLFWDASMENKTKL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Biological Role: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| molsidomine (CHEBI:31861) has role antioxidant (CHEBI:22586) |
| molsidomine (CHEBI:31861) has role apoptosis inhibitor (CHEBI:68494) |
| molsidomine (CHEBI:31861) has role cardioprotective agent (CHEBI:77307) |
| molsidomine (CHEBI:31861) has role nitric oxide donor (CHEBI:50566) |
| molsidomine (CHEBI:31861) has role vasodilator agent (CHEBI:35620) |
| molsidomine (CHEBI:31861) is a ethyl ester (CHEBI:23990) |
| molsidomine (CHEBI:31861) is a morpholines (CHEBI:38785) |
| molsidomine (CHEBI:31861) is a oxadiazole (CHEBI:46685) |
| molsidomine (CHEBI:31861) is a zwitterion (CHEBI:27369) |
| IUPAC Name |
|---|
| N-(ethoxycarbonyl)-3-(morpholin-4-yl)-1,2,3-oxadiazol-3-ium-5-aminide |
| INNs | Source |
|---|---|
| molsidomine | WHO MedNet |
| molsidominum | WHO MedNet |
| molsidomina | WHO MedNet |
| molsidomine | WHO MedNet |
| Synonyms | Source |
|---|---|
| molsidomin | DrugCentral |
| N-ethoxycarbonyl-3-morpholinosydnonimine | ChemIDplus |
| N-(ethoxycarbonyl)-3-morpholinosydnone imine | ChEBI |
| SIN-10 | ChemIDplus |
| CAS-276 | DrugBank |
| CAS 276 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Motazomin | ChemIDplus |
| Morsydomine | DrugCentral |
| Corvaton | ChemIDplus |
| Covarsal | ChemIDplus |
| Molsidolat | ChemIDplus |
| Morial | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB09282 | DrugBank |
| D01320 | KEGG DRUG |
| 1831 | DrugCentral |
| HMDB0245703 | HMDB |
| Molsidomine | Wikipedia |
| 4090 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3999414 | Reaxys |
| CAS:25717-80-0 | ChemIDplus |
| Citations |
|---|