EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O6 |
| Net Charge | 0 |
| Average Mass | 259.218 |
| Monoisotopic Mass | 259.08044 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C9H13N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,9,13-15,17H,1H2,(H2,10,16)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | HZQDCMWJEBCWBR-UUOKFMHZSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mizoribine (CHEBI:31858) has role anticoronaviral agent (CHEBI:149553) |
| Mizoribine (CHEBI:31858) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| beta-Bredinin | DrugCentral |
| bredinin | DrugCentral |
| Mizoribine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3363 | DrugCentral |
| D01392 | KEGG DRUG |
| HMDB0041934 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:50924-49-7 | KEGG COMPOUND |