EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31856 - mithramycin
| Formula | C52H76O24 |
| Net Charge | 0 |
| Average Mass | 1085.156 |
| Monoisotopic Mass | 1084.47265 |
| SMILES | [H][C@@]1([C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)Cc2cc3cc(O[C@H]4C[C@@H](O[C@H]5C[C@@H](O)[C@H](O)[C@@H](C)O5)[C@H](O)[C@@H](C)O4)c(C)c(O)c3c(O)c2C(=O)[C@H]1O[C@H]1C[C@@H](O[C@H]2C[C@@H](O[C@H]3C[C@](C)(O)[C@H](O)[C@@H](C)O3)[C@@H](O)[C@@H](C)O2)[C@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C52H76O24/c1-18-29(72-34-14-30(43(58)21(4)68-34)73-33-13-28(54)42(57)20(3)67-33)12-26-10-25-11-27(49(66-9)48(63)41(56)19(2)53)50(47(62)39(25)46(61)38(26)40(18)55)76-36-16-31(44(59)23(6)70-36)74-35-15-32(45(60)22(5)69-35)75-37-17-52(8,65)51(64)24(7)71-37/h10,12,19-24,27-28,30-37,41-45,49-51,53-61,64-65H,11,13-17H2,1-9H3/t19-,20-,21-,22-,23-,24-,27+,28-,30-,31-,32-,33+,34+,35+,36+,37+,41+,42-,43-,44-,45+,49+,50+,51-,52+/m1/s1 |
| InChIKey | CFCUWKMKBJTWLW-BKHRDMLASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces plicatus (ncbitaxon:1922) | - | DOI (10.1016/S1054-3589(08)60218-5) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mithramycin (CHEBI:31856) has functional parent mithramycin DK (CHEBI:81906) |
| mithramycin (CHEBI:31856) has role antineoplastic agent (CHEBI:35610) |
| mithramycin (CHEBI:31856) has role bacterial metabolite (CHEBI:76969) |
| mithramycin (CHEBI:31856) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| mithramycin (CHEBI:31856) is a anthracycline antibiotic (CHEBI:49322) |
| mithramycin (CHEBI:31856) is a aureolic acid (CHEBI:52513) |
| mithramycin (CHEBI:31856) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| mithramycin (CHEBI:31856) is a carbotricyclic compound (CHEBI:38032) |
| mithramycin (CHEBI:31856) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (1S)-5-deoxy-1-C-[(2S,3S)-7-{[2,6-dideoxy-3-O-(2,6-dideoxy-β-D-arabino-hexopyranosyl)-β-D-arabino-hexopyranosyl]oxy}-3-{[2,6-dideoxy-3-C-methyl-β-D-ribo-hexopyranosyl-(1→3)-2,6-dideoxy-β-D-arabino-hexopyranosyl-(1→3)-2,6-dideoxy-β-D-arabino-hexopyranosyl]oxy}-5,10-dihydroxy-6-methyl-4-oxo-1,2,3,4-tetrahydroanthracen-2-yl]-1-O-methyl-D-xylulose |
| INNs | Source |
|---|---|
| plicamicina | WHO MedNet |
| plicamycine | WHO MedNet |
| plicamycinum | WHO MedNet |
| plicamycin | WHO MedNet |
| Synonyms | Source |
|---|---|
| Mithracin | KEGG DRUG |
| Mithramycine | ChemIDplus |
| Mithramycinum | ChemIDplus |
| aureolic acid | ChemIDplus |
| UniProt Name | Source |
|---|---|
| mithramycin | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:18378-89-7 | KEGG COMPOUND |
| CAS:18378-89-7 | ChemIDplus |
| Citations |
|---|