EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O3 |
| Net Charge | 0 |
| Average Mass | 256.301 |
| Monoisotopic Mass | 256.10994 |
| SMILES | COc1ccc([C@@H]2CCc3ccc(O)cc3O2)cc1 |
| InChI | InChI=1S/C16H16O3/c1-18-14-7-3-11(4-8-14)15-9-5-12-2-6-13(17)10-16(12)19-15/h2-4,6-8,10,15,17H,5,9H2,1H3/t15-/m0/s1 |
| InChIKey | JTPMXGZHRQYFTB-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dracaena cochinchinensis (ncbitaxon:593754) | - | PubMed (12016928) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| broussin (CHEBI:3185) has functional parent (2S)-flavan (CHEBI:36103) |
| broussin (CHEBI:3185) has role plant metabolite (CHEBI:76924) |
| broussin (CHEBI:3185) is a hydroxyflavan (CHEBI:72010) |
| broussin (CHEBI:3185) is a methoxyflavan (CHEBI:72585) |
| IUPAC Name |
|---|
| (2S)-2-(4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-7-ol |
| Synonym | Source |
|---|---|
| 7-Hydroxy-4'-methoxyflavan | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000943 | KNApSAcK |
| C09505 | KEGG COMPOUND |
| LMPK12020232 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5070640 | Reaxys |
| CAS:76045-50-6 | KEGG COMPOUND |
| Citations |
|---|