EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 363.244 |
| Monoisotopic Mass | 362.05888 |
| SMILES | CC1COC2(c3ccccc3Cl)c3cc(Cl)ccc3NC(=O)CN12 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-11-10-24-18(13-4-2-3-5-15(13)20)14-8-12(19)6-7-16(14)21-17(23)9-22(11)18/h2-8,11H,9-10H2,1H3,(H,21,23) |
| InChIKey | ANUCDXCTICZJRH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mexazolam (CHEBI:31842) has role anxiolytic drug (CHEBI:35474) |
| mexazolam (CHEBI:31842) is a hemiaminal ether (CHEBI:141498) |
| mexazolam (CHEBI:31842) is a oxazolobenzodiazepine (CHEBI:35502) |
| Synonyms | Source |
|---|---|
| CS-386 | ChEMBL |
| melex | DrugCentral |
| methylcloxazolam | DrugCentral |
| Mexazolam | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:31868-18-5 | ChemIDplus |