EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO2S |
| Net Charge | 0 |
| Average Mass | 271.341 |
| Monoisotopic Mass | 271.06670 |
| SMILES | CN1c2ccccc2Sc2ccc(CC(=O)O)cc21 |
| InChI | InChI=1S/C15H13NO2S/c1-16-11-4-2-3-5-13(11)19-14-7-6-10(8-12(14)16)9-15(17)18/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | LMINNBXUMGNKMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metiazinic acid (CHEBI:31838) has functional parent 10H-phenothiazine (CHEBI:37931) |
| metiazinic acid (CHEBI:31838) has role drug allergen (CHEBI:88188) |
| metiazinic acid (CHEBI:31838) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| metiazinic acid (CHEBI:31838) is a phenothiazines (CHEBI:38093) |
| IUPAC Name |
|---|
| (10-methyl-10H-phenothiazin-2-yl)acetic acid |
| INNs | Source |
|---|---|
| acide metiazinique | ChemIDplus |
| acido metiazinico | ChemIDplus |
| acidum metiazinicum | ChemIDplus |
| metiazinic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (10-Methyl-2-phenothiazinyl)acetic acid | ChemIDplus |
| 10-Methylphenothiazine-2-acetic acid | ChemIDplus |
| 2-(10-Methyl-2-phenothiazinyl)essigsäure | ChemIDplus |
| Methiazinic acid | ChemIDplus |
| N-Methyl-3-phenothiazinylacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:619561 | Beilstein |
| CAS:13993-65-2 | ChemIDplus |
| Citations |
|---|