EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO2S |
| Net Charge | 0 |
| Average Mass | 271.341 |
| Monoisotopic Mass | 271.06670 |
| SMILES | CN1c2ccccc2Sc2ccc(CC(=O)O)cc21 |
| InChI | InChI=1S/C15H13NO2S/c1-16-11-4-2-3-5-13(11)19-14-7-6-10(8-12(14)16)9-15(17)18/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | LMINNBXUMGNKMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metiazinic acid (CHEBI:31838) has functional parent 10H-phenothiazine (CHEBI:37931) |
| metiazinic acid (CHEBI:31838) has role drug allergen (CHEBI:88188) |
| metiazinic acid (CHEBI:31838) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| metiazinic acid (CHEBI:31838) is a phenothiazines (CHEBI:38093) |
| IUPAC Name |
|---|
| (10-methyl-10H-phenothiazin-2-yl)acetic acid |
| INNs | Source |
|---|---|
| acide metiazinique | ChemIDplus |
| acido metiazinico | ChemIDplus |
| acidum metiazinicum | ChemIDplus |
| metiazinic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (10-Methyl-2-phenothiazinyl)acetic acid | ChemIDplus |
| 10-Methylphenothiazine-2-acetic acid | ChemIDplus |
| 2-(10-Methyl-2-phenothiazinyl)essigsäure | ChemIDplus |
| Methiazinic acid | ChemIDplus |
| N-Methyl-3-phenothiazinylacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:619561 | Beilstein |
| CAS:13993-65-2 | ChemIDplus |
| Citations |
|---|