EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | COC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5,9H,1H3 |
| InChIKey | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylparaben (CHEBI:31835) has role antifungal agent (CHEBI:35718) |
| methylparaben (CHEBI:31835) has role antimicrobial food preservative (CHEBI:65256) |
| methylparaben (CHEBI:31835) has role neuroprotective agent (CHEBI:63726) |
| methylparaben (CHEBI:31835) has role plant metabolite (CHEBI:76924) |
| methylparaben (CHEBI:31835) is a paraben (CHEBI:85122) |
| IUPAC Name |
|---|
| methyl 4-hydroxybenzoate |
| Synonyms | Source |
|---|---|
| methyl p-hydroxybenzoate | ChemIDplus |
| E218 | ChEBI |
| methyl paraben | ChemIDplus |
| 4-hydroxybenzoic acid methyl ester | ChemIDplus |
| p-hydroxybenzoic acid methyl ester | ChemIDplus |
| p-methoxycarbonylphenol | ChemIDplus |
| Brand Names | Source |
|---|---|
| Methaben | ChemIDplus |
| Metaben | ChemIDplus |
| Metoxyde | ChemIDplus |
| Tegosept M | ChemIDplus |
| Nipagin | ChemIDplus |
| Preserval | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Methylparaben | Wikipedia |
| MPB | PDBeChem |
| HMDB0032572 | HMDB |
| D01400 | KEGG DRUG |
| 1766 | DrugCentral |
| Citations |
|---|