EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:31835 - methylparaben
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | COC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5,9H,1H3 |
| InChIKey | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylparaben (CHEBI:31835) has role antifungal agent (CHEBI:35718) |
| methylparaben (CHEBI:31835) has role antimicrobial food preservative (CHEBI:65256) |
| methylparaben (CHEBI:31835) has role neuroprotective agent (CHEBI:63726) |
| methylparaben (CHEBI:31835) has role plant metabolite (CHEBI:76924) |
| methylparaben (CHEBI:31835) is a paraben (CHEBI:85122) |
| IUPAC Name |
|---|
| methyl 4-hydroxybenzoate |
| Synonyms | Source |
|---|---|
| 4-hydroxybenzoic acid methyl ester | ChemIDplus |
| E 218 | ChEBI |
| E-218 | ChEMBL |
| E218 | ChEBI |
| p-carbomethoxyphenol | ChemIDplus |
| p-hydroxybenzoic acid methyl ester | ChemIDplus |
| Brand Names | Source |
|---|---|
| Maseptol | ChemIDplus |
| Metaben | ChemIDplus |
| Methaben | ChemIDplus |
| Methyl butex | ChemIDplus |
| Methyl chemosept | ChemIDplus |
| Metoxyde | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1766 | DrugCentral |
| D01400 | KEGG DRUG |
| HMDB0032572 | HMDB |
| Methylparaben | Wikipedia |
| MPB | PDBeChem |
| Citations |
|---|