EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4(C)O)[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C20H32O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h13,15-17,22H,4-12H2,1-3H3/t13-,15+,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | WYZDXEKUWRCKOB-YDSAWKJFSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mestanolone (CHEBI:31825) has role androgen (CHEBI:50113) |
| Mestanolone (CHEBI:31825) is a 3-oxo-5α-steroid (CHEBI:13601) |
| INN | Source |
|---|---|
| mestanolona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Assimil | ChEMBL |
| Ermalone | ChEMBL |
| mesanolon | DrugCentral |
| mestaline | DrugCentral |
| mestalone | DrugCentral |
| mestanolon | DrugCentral |
| Citations |
|---|