EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18F3N3O3 |
| Net Charge | 0 |
| Average Mass | 369.343 |
| Monoisotopic Mass | 369.13003 |
| SMILES | CN1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(CCF)c3c2F)CC1 |
| InChI | InChI=1S/C17H18F3N3O3/c1-21-4-6-22(7-5-21)15-12(19)8-10-14(13(15)20)23(3-2-18)9-11(16(10)24)17(25)26/h8-9H,2-7H2,1H3,(H,25,26) |
| InChIKey | XBJBPGROQZJDOJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fleroxacin (CHEBI:31810) has role antibacterial drug (CHEBI:36047) |
| fleroxacin (CHEBI:31810) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| fleroxacin (CHEBI:31810) has role topoisomerase IV inhibitor (CHEBI:53559) |
| fleroxacin (CHEBI:31810) is a N-alkylpiperazine (CHEBI:46845) |
| fleroxacin (CHEBI:31810) is a difluorobenzene (CHEBI:38582) |
| fleroxacin (CHEBI:31810) is a fluoroquinolone antibiotic (CHEBI:87211) |
| fleroxacin (CHEBI:31810) is a monocarboxylic acid (CHEBI:25384) |
| fleroxacin (CHEBI:31810) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 6,8-difluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INN | Source |
|---|---|
| fleroxacin | ChemIDplus |
| Synonyms | Source |
|---|---|
| fleroxacino | DrugBank |
| fleroxacinum | DrugBank |
| fleroxacine | DrugBank |
| 6,8-difluoro-1-(2-fluoroethyl)-1,4-dihydro-7-(4-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4300996 | Reaxys |
| CAS:79660-72-3 | KEGG COMPOUND |
| CAS:79660-72-3 | ChemIDplus |
| Citations |
|---|