EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19ClN2O5S2 |
| Net Charge | 0 |
| Average Mass | 382.891 |
| Monoisotopic Mass | 382.04239 |
| SMILES | CN(CC1(C)CCCO1)S(=O)(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H19ClN2O5S2/c1-13(6-3-7-21-13)9-16(2)23(19,20)10-4-5-11(14)12(8-10)22(15,17)18/h4-5,8H,3,6-7,9H2,1-2H3,(H2,15,17,18) |
| InChIKey | SMNOERSLNYGGOU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mefruside (CHEBI:31809) has role cardiovascular drug (CHEBI:35554) |
| Mefruside (CHEBI:31809) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| mefrusida | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 1500 | ChEMBL |
| BAY-1500 | ChEMBL |
| mefrusid | DrugCentral |
| Mefruside | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Baycaron | ChEMBL |
| Citations |
|---|