EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO8 |
| Net Charge | 0 |
| Average Mass | 457.479 |
| Monoisotopic Mass | 457.17367 |
| SMILES | [H][C@]1(c2ccc3c(c2O)C(=O)C2=C(C3=O)[C@@]3([H])OC(=O)C[C@@]3([H])O[C@@H]2C)C[C@@H](N(C)C)[C@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C24H27NO8/c1-9-17-19(24-15(31-9)8-16(26)33-24)22(29)12-6-5-11(21(28)18(12)23(17)30)14-7-13(25(3)4)20(27)10(2)32-14/h5-6,9-10,13-15,20,24,27-28H,7-8H2,1-4H3/t9-,10-,13-,14-,15-,20-,24+/m1/s1 |
| InChIKey | NYJGMJFBEVSQNN-CNRHASOASA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Medermycin (CHEBI:31808) is a p-quinones (CHEBI:25830) |
| Medermycin (CHEBI:31808) is a benzoisochromanequinone (CHEBI:48129) |
| Synonym | Source |
|---|---|
| Medermycin | KEGG COMPOUND |