EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15ClN2 |
| Net Charge | 0 |
| Average Mass | 270.763 |
| Monoisotopic Mass | 270.09238 |
| SMILES | CN1CCN=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H15ClN2/c1-19-10-9-18-16(12-5-3-2-4-6-12)14-11-13(17)7-8-15(14)19/h2-8,11H,9-10H2,1H3 |
| InChIKey | YLCXGBZIZBEVPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Medazepam (CHEBI:31807) has role anxiolytic drug (CHEBI:35474) |
| Medazepam (CHEBI:31807) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Medazepam | KEGG COMPOUND |
| medazepam HCl | DrugCentral |
| medazepam hydrochloride | DrugCentral |
| mezapam | DrugCentral |
| Pamnace | ChEMBL |
| Brand Name | Source |
|---|---|
| Nobrium | ChEMBL |
| Citations |
|---|