EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20N2O4 |
| Net Charge | 0 |
| Average Mass | 232.280 |
| Monoisotopic Mass | 232.14231 |
| SMILES | CCC(C)C(C)(COC(N)=O)COC(N)=O |
| InChI | InChI=1S/C10H20N2O4/c1-4-7(2)10(3,5-15-8(11)13)6-16-9(12)14/h7H,4-6H2,1-3H3,(H2,11,13)(H2,12,14) |
| InChIKey | LEROTMJVBFSIMP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mebutamate (CHEBI:31804) has role anxiolytic drug (CHEBI:35474) |
| Mebutamate (CHEBI:31804) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| mebutamato | WHO MedNet |
| Synonyms | Source |
|---|---|
| Axiten | ChEMBL |
| butatensin | DrugCentral |
| Carbuten | ChEMBL |
| dicamoylmethane | DrugCentral |
| Encapla | ChEMBL |
| Ipotensivo | ChEMBL |
| Brand Names | Source |
|---|---|
| Capla | ChEMBL |
| Dormate | ChEMBL |
| No-press | ChEMBL |
| Citations |
|---|