EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2.C7H10N2O2S |
| Net Charge | 0 |
| Average Mass | 246.288 |
| Monoisotopic Mass | 246.06743 |
| SMILES | CC(=O)O.NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H10N2O2S.C2H4O2/c8-5-6-1-3-7(4-2-6)12(9,10)11;1-2(3)4/h1-4H,5,8H2,(H2,9,10,11);1H3,(H,3,4) |
| InChIKey | UILOTUUZKGTYFQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mafenide acetate (CHEBI:31792) has role antibacterial agent (CHEBI:33282) |
| Mafenide acetate (CHEBI:31792) is a carboxylic acid (CHEBI:33575) |
| Synonym | Source |
|---|---|
| Mafenide acetate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01166 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:13009-99-9 | KEGG COMPOUND |
| Citations |
|---|