EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10ClN3O4S2 |
| Net Charge | 0 |
| Average Mass | 371.827 |
| Monoisotopic Mass | 370.98013 |
| SMILES | CN1C(C(=O)Nc2ccccn2)=C(O)c2sc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C13H10ClN3O4S2/c1-17-10(13(19)16-9-4-2-3-5-15-9)11(18)12-7(23(17,20)21)6-8(14)22-12/h2-6,18H,1H3,(H,15,16,19) |
| InChIKey | WLHQHAUOOXYABV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lornoxicam (CHEBI:31783) has role antipyretic (CHEBI:35493) |
| lornoxicam (CHEBI:31783) has role non-narcotic analgesic (CHEBI:35481) |
| lornoxicam (CHEBI:31783) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| lornoxicam (CHEBI:31783) is a heteroaryl hydroxy compound (CHEBI:74818) |
| lornoxicam (CHEBI:31783) is a monocarboxylic acid amide (CHEBI:29347) |
| lornoxicam (CHEBI:31783) is a organochlorine compound (CHEBI:36683) |
| lornoxicam (CHEBI:31783) is a pyridines (CHEBI:26421) |
| lornoxicam (CHEBI:31783) is a thienothiazine (CHEBI:46977) |
| IUPAC Name |
|---|
| 6-chloro-4-hydroxy-2-methyl-N-(pyridin-2-yl)-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide 1,1-dioxide |
| INNs | Source |
|---|---|
| lornoxicam | KEGG DRUG |
| lornoxicamum | DrugBank |
| lornoxicam | WHO MedNet |
| lornoxicam | WHO MedNet |
| Synonyms | Source |
|---|---|
| CCRIS 8589 | ChemIDplus |
| Ro 13-9297 | ChemIDplus |
| Chlortenoxicam | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB06725 | DrugBank |
| D01866 | KEGG DRUG |
| US2008014272 | Patent |
| Lornoxicam | Wikipedia |
| 1609 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1039965 | Reaxys |
| CAS:70374-39-9 | KEGG DRUG |
| CAS:70374-39-9 | ChemIDplus |
| Citations |
|---|