EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27ClN2O.HCl |
| Net Charge | 0 |
| Average Mass | 455.429 |
| Monoisotopic Mass | 454.15787 |
| SMILES | CN(CCCN1c2ccccc2CCc2ccccc21)CC(=O)c1ccc(Cl)cc1.[H]Cl |
| InChI | InChI=1S/C26H27ClN2O.ClH/c1-28(19-26(30)22-13-15-23(27)16-14-22)17-6-18-29-24-9-4-2-7-20(24)11-12-21-8-3-5-10-25(21)29;/h2-5,7-10,13-16H,6,11-12,17-19H2,1H3;1H |
| InChIKey | ZWZIQPOLMDPIQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lofepramine hydrochloride (CHEBI:31780) has part lofepramine (CHEBI:47782) |
| lofepramine hydrochloride (CHEBI:31780) has role antidepressant (CHEBI:35469) |
| lofepramine hydrochloride (CHEBI:31780) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(4-chlorophenyl)-2-{[3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)propyl](methyl)amino}ethanone hydrochloride |
| Synonyms | Source |
|---|---|
| Lofepramine hydrochloride | ChemIDplus |
| clopepramine hydrochloride | ChemIDplus |
| 4'-chloro-2-((3-(10,11-dihydro-5H-dibenz(b,f)azepin-5-yl)propyl)methylamino)acetophenone monohydrochloride | ChemIDplus |
| 1-(4-chlorophenyl)-2-((3-(10,11-dihydro-5H-dibenz(b,f)azepin-5-yl)propyl)methylamino)ethan-1-one monohydrochloride | ChemIDplus |
| Gamonil | ChemIDplus |
| 1-(4-chlorophenyl)-2-{[3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)propyl]methylamino}ethanone hydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01285 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6555366 | Beilstein |
| CAS:26786-32-3 | ChemIDplus |