EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4Pb |
| Net Charge | 0 |
| Average Mass | 325.288 |
| Monoisotopic Mass | 326.00326 |
| SMILES | CC1=[O][Pb]2([O]1)[O]C(C)=[O]2 |
| InChI | InChI=1S/2C2H4O2.Pb/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | GUWSLQUAAYEZAF-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Applications: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. sweetening agent Substance that sweeten food, beverages, medications, etc. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lead diacetate (CHEBI:31767) has part lead(2+) (CHEBI:49807) |
| lead diacetate (CHEBI:31767) has role astringent (CHEBI:74783) |
| lead diacetate (CHEBI:31767) has role insecticide (CHEBI:24852) |
| lead diacetate (CHEBI:31767) has role sweetening agent (CHEBI:50505) |
| lead diacetate (CHEBI:31767) is a lead coordination entity (CHEBI:37185) |
| Incoming Relation(s) |
| lead diacetate trihydrate (CHEBI:33112) has part lead diacetate (CHEBI:31767) |
| IUPAC Names |
|---|
| bis(acetato-κ2O,O')lead |
| lead(2+) acetate |
| lead(2+) diacetate |
| lead(II) acetate |
| Synonyms | Source |
|---|---|
| acetate de plomb | ChemIDplus |
| acetic acid lead(2+) salt | ChemIDplus |
| acetic acid, lead(2+) salt | ChemIDplus |
| acetic acid lead salt | ChemIDplus |
| acetic acid, lead salt | ChemIDplus |
| Bleidiacetat | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8956 | ChemSpider |
| D01945 | KEGG DRUG |
| Lead(II)_acetate | Wikipedia |
| Citations |
|---|