EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31767 - lead diacetate
| Formula | C4H6O4Pb |
| Net Charge | 0 |
| Average Mass | 325.288 |
| Monoisotopic Mass | 326.00326 |
| SMILES | CC1=[O][Pb]2([O]1)[O]C(C)=[O]2 |
| InChI | InChI=1S/2C2H4O2.Pb/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | GUWSLQUAAYEZAF-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. sweetening agent Substance that sweeten food, beverages, medications, etc. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lead diacetate (CHEBI:31767) has part lead(2+) (CHEBI:49807) |
| lead diacetate (CHEBI:31767) has role astringent (CHEBI:74783) |
| lead diacetate (CHEBI:31767) has role insecticide (CHEBI:24852) |
| lead diacetate (CHEBI:31767) has role sweetening agent (CHEBI:50505) |
| lead diacetate (CHEBI:31767) is a lead coordination entity (CHEBI:37185) |
| Incoming Relation(s) |
| lead diacetate trihydrate (CHEBI:33112) has part lead diacetate (CHEBI:31767) |
| IUPAC Names |
|---|
| lead(2+) acetate |
| lead(II) acetate |
| bis(acetato-κ2O,O')lead |
| lead(2+) diacetate |
| Synonyms | Source |
|---|---|
| Bleidiazetat | ChEBI |
| Blei(II)-azetat | ChEBI |
| Bleidiacetat | ChEBI |
| salt of Saturn | ChEBI |
| sugar of lead | ChemIDplus |
| plumbous acetate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01945 | KEGG DRUG |
| Lead(II)_acetate | Wikipedia |
| 8956 | ChemSpider |
| Citations |
|---|