EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10ClN3S2 |
| Net Charge | 0 |
| Average Mass | 319.842 |
| Monoisotopic Mass | 319.00047 |
| SMILES | N#C/C(=C1/SCC(c2ccccc2Cl)S1)n1ccnc1 |
| InChI | InChI=1S/C14H10ClN3S2/c15-11-4-2-1-3-10(11)13-8-19-14(20-13)12(7-16)18-6-5-17-9-18/h1-6,9,13H,8H2/b14-12+ |
| InChIKey | ZRTQSJFIDWNVJW-WYMLVPIESA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lanoconazole (CHEBI:31761) is a conazole antifungal drug (CHEBI:87071) |
| Lanoconazole (CHEBI:31761) is a imidazole antifungal drug (CHEBI:87069) |
| Synonyms | Source |
|---|---|
| Lanoconazole | KEGG COMPOUND |
| latoconazole | DrugCentral |
| NND-318 | DrugCentral |