EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N3O4S |
| Net Charge | 0 |
| Average Mass | 431.558 |
| Monoisotopic Mass | 431.18788 |
| SMILES | O=C(CS(=O)Cc1ccco1)NC/C=C\COc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2- |
| InChIKey | KMZQAVXSMUKBPD-DJWKRKHSSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lafutidine (CHEBI:31759) has role anti-ulcer drug (CHEBI:49201) |
| Lafutidine (CHEBI:31759) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| lafutidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| FRG 8813 | DrugCentral |
| FRG-8813 | DrugCentral |
| laflutidine | DrugCentral |
| Lafutidine | KEGG COMPOUND |
| protecadin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1537 | DrugCentral |
| D01131 | KEGG DRUG |
| HMDB0240216 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:118288-08-7 | KEGG COMPOUND |
| CAS:206449-93-6 | DrugCentral |
| Citations |
|---|