EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10BrN5 |
| Net Charge | 0 |
| Average Mass | 292.140 |
| Monoisotopic Mass | 291.01196 |
| SMILES | Brc1c(NC2=NCCN2)ccc2nccnc12 |
| InChI | InChI=1S/C11H10BrN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17) |
| InChIKey | XYLJNLCSTIOKRM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brimonidine (CHEBI:3175) has role adrenergic agonist (CHEBI:37886) |
| brimonidine (CHEBI:3175) has role antihypertensive agent (CHEBI:35674) |
| brimonidine (CHEBI:3175) has role α-adrenergic agonist (CHEBI:35569) |
| brimonidine (CHEBI:3175) is a imidazoles (CHEBI:24780) |
| brimonidine (CHEBI:3175) is a quinoxaline derivative (CHEBI:38771) |
| brimonidine (CHEBI:3175) is a secondary amine (CHEBI:32863) |
| Incoming Relation(s) |
| brimonidine tartrate (CHEBI:51157) has part brimonidine (CHEBI:3175) |
| IUPAC Name |
|---|
| 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
| INNs | Source |
|---|---|
| brimonidina | ChEBI |
| brimonidine | WHO MedNet |
| brimonidinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-Bromo-6-(2-imidazolin-2-ylamino)quinoxaline | ChemIDplus |
| brimonidine | ChemIDplus |
| Brimonidine | KEGG COMPOUND |
| Bromoxidine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:751629 | Beilstein |
| CAS:59803-98-4 | ChemIDplus |