EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10BrN5 |
| Net Charge | 0 |
| Average Mass | 292.140 |
| Monoisotopic Mass | 291.01196 |
| SMILES | Brc1c(NC2=NCCN2)ccc2nccnc12 |
| InChI | InChI=1S/C11H10BrN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17) |
| InChIKey | XYLJNLCSTIOKRM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brimonidine (CHEBI:3175) has role adrenergic agonist (CHEBI:37886) |
| brimonidine (CHEBI:3175) has role antiglaucoma drug (CHEBI:39456) |
| brimonidine (CHEBI:3175) has role antihypertensive agent (CHEBI:35674) |
| brimonidine (CHEBI:3175) has role ophthalmology drug (CHEBI:66981) |
| brimonidine (CHEBI:3175) has role α-adrenergic agonist (CHEBI:35569) |
| brimonidine (CHEBI:3175) is a imidazoles (CHEBI:24780) |
| brimonidine (CHEBI:3175) is a quinoxaline derivative (CHEBI:38771) |
| brimonidine (CHEBI:3175) is a secondary amine (CHEBI:32863) |
| Incoming Relation(s) |
| brimonidine tartrate (CHEBI:51157) has part brimonidine (CHEBI:3175) |
| IUPAC Name |
|---|
| 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
| INNs | Source |
|---|---|
| brimonidina | ChEBI |
| brimonidine | WHO MedNet |
| brimonidinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-Bromo-6-(2-imidazolin-2-ylamino)quinoxaline | ChemIDplus |
| AGN-190342 FREE BASE | ChEMBL |
| brimonidine | ChemIDplus |
| Brimonidine | KEGG COMPOUND |
| Bromoxidine | ChemIDplus |
| NSC-318825 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:751629 | Beilstein |
| CAS:59803-98-4 | ChemIDplus |
| Citations |
|---|