EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3175 - brimonidine
| Formula | C11H10BrN5 |
| Net Charge | 0 |
| Average Mass | 292.140 |
| Monoisotopic Mass | 291.01196 |
| SMILES | Brc1c(NC2=NCCN2)ccc2nccnc12 |
| InChI | InChI=1S/C11H10BrN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17) |
| InChIKey | XYLJNLCSTIOKRM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brimonidine (CHEBI:3175) has role adrenergic agonist (CHEBI:37886) |
| brimonidine (CHEBI:3175) has role antiglaucoma drug (CHEBI:39456) |
| brimonidine (CHEBI:3175) has role antihypertensive agent (CHEBI:35674) |
| brimonidine (CHEBI:3175) has role ophthalmology drug (CHEBI:66981) |
| brimonidine (CHEBI:3175) has role α-adrenergic agonist (CHEBI:35569) |
| brimonidine (CHEBI:3175) is a imidazoles (CHEBI:24780) |
| brimonidine (CHEBI:3175) is a organic molecular entity (CHEBI:50860) |
| brimonidine (CHEBI:3175) is a quinoxaline derivative (CHEBI:38771) |
| brimonidine (CHEBI:3175) is a secondary amine (CHEBI:32863) |
| Incoming Relation(s) |
| brimonidine tartrate (CHEBI:51157) has part brimonidine (CHEBI:3175) |
| IUPAC Name |
|---|
| 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
| INNs | Source |
|---|---|
| brimonidina | ChEBI |
| brimonidine | WHO MedNet |
| brimonidinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-Bromo-6-(2-imidazolin-2-ylamino)quinoxaline | ChemIDplus |
| AGN-190342 FREE BASE | ChEMBL |
| brimonidine | ChemIDplus |
| Brimonidine | KEGG COMPOUND |
| Bromoxidine | ChemIDplus |
| NSC-318825 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:751629 | Beilstein |
| CAS:59803-98-4 | ChemIDplus |
| Citations |
|---|