EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10BrN5 |
| Net Charge | 0 |
| Average Mass | 292.140 |
| Monoisotopic Mass | 291.01196 |
| SMILES | Brc1c(NC2=NCCN2)ccc2nccnc12 |
| InChI | InChI=1S/C11H10BrN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17) |
| InChIKey | XYLJNLCSTIOKRM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brimonidine (CHEBI:3175) has role adrenergic agonist (CHEBI:37886) |
| brimonidine (CHEBI:3175) has role antihypertensive agent (CHEBI:35674) |
| brimonidine (CHEBI:3175) has role α-adrenergic agonist (CHEBI:35569) |
| brimonidine (CHEBI:3175) is a imidazoles (CHEBI:24780) |
| brimonidine (CHEBI:3175) is a quinoxaline derivative (CHEBI:38771) |
| brimonidine (CHEBI:3175) is a secondary amine (CHEBI:32863) |
| Incoming Relation(s) |
| brimonidine tartrate (CHEBI:51157) has part brimonidine (CHEBI:3175) |
| IUPAC Name |
|---|
| 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
| INNs | Source |
|---|---|
| brimonidina | ChEBI |
| brimonidine | WHO MedNet |
| brimonidinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-Bromo-6-(2-imidazolin-2-ylamino)quinoxaline | ChemIDplus |
| brimonidine | ChemIDplus |
| Brimonidine | KEGG COMPOUND |
| Bromoxidine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:751629 | Beilstein |
| CAS:59803-98-4 | ChemIDplus |