EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO4 |
| Net Charge | 0 |
| Average Mass | 213.233 |
| Monoisotopic Mass | 213.10011 |
| SMILES | C=C(C)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C10H15NO4/c1-5(2)7-4-11-9(10(14)15)6(7)3-8(12)13/h6-7,9,11H,1,3-4H2,2H3,(H,12,13)(H,14,15)/t6-,7+,9-/m0/s1 |
| InChIKey | VLSMHEGGTFMBBZ-OOZYFLPDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| Applications: | antinematodal drug A substance used in the treatment or control of nematode infestations. excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kainic acid (CHEBI:31746) has role antinematodal drug (CHEBI:35444) |
| kainic acid (CHEBI:31746) has role excitatory amino acid agonist (CHEBI:50103) |
| kainic acid (CHEBI:31746) is a L-proline derivative (CHEBI:84186) |
| kainic acid (CHEBI:31746) is a dicarboxylic acid (CHEBI:35692) |
| kainic acid (CHEBI:31746) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| kainic acid (CHEBI:31746) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| kainic acid (CHEBI:31746) is conjugate acid of kainate(1−) (CHEBI:156548) |
| Incoming Relation(s) |
| dihydrokainic acid (CHEBI:43562) has functional parent kainic acid (CHEBI:31746) |
| kainate(1−) (CHEBI:156548) is conjugate base of kainic acid (CHEBI:31746) |
| IUPAC Name |
|---|
| (3S,4R)-3-(carboxymethyl)-4-(prop-1-en-2-yl)-L-proline |
| INNs | Source |
|---|---|
| acide kaïnique | ChemIDplus |
| ácido kaínico | ChemIDplus |
| acidum kainicum | ChemIDplus |
| kainic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S-(2α,3β,4β))-2-carboxy-4-(1-methylethenyl)-3-pyrrolidineacetic acid | ChemIDplus |
| alpha- Kainic acid | KEGG COMPOUND |
| alpha-Kainic acid | KEGG COMPOUND |
| digenic acid | ChemIDplus |
| Digenin | ChemIDplus |
| Digensäure | ChEBI |