EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31NO9 |
| Net Charge | 0 |
| Average Mass | 549.576 |
| Monoisotopic Mass | 549.19988 |
| SMILES | [H]C12OC(=O)[C@]([H])([C@@H](C)CC)N1C1=C(C(=O)c3cccc(O[C@H]4C[C@@H](O)[C@@H](O)[C@H](C)O4)c3C1=O)c1c(O)cc(C)cc12 |
| InChI | InChI=1S/C30H31NO9/c1-5-13(3)24-30(37)40-29-16-9-12(2)10-17(32)21(16)23-25(31(24)29)28(36)22-15(27(23)35)7-6-8-19(22)39-20-11-18(33)26(34)14(4)38-20/h6-10,13-14,18,20,24,26,29,32-34H,5,11H2,1-4H3/t13-,14-,18+,20-,24-,26-,29?/m0/s1 |
| InChIKey | BSBSCJRAEMDCHC-LVOPHWFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces venezuelae (ncbitaxon:54571) | |||
| cell suspension culture (BTO:0000221) | PubMed (21565515) | Strain: ISP5230 | |
| - | PubMed (8514643) | Strain: ISP5230 |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jadomycin B (CHEBI:31738) has functional parent jadomycin A (CHEBI:81887) |
| jadomycin B (CHEBI:31738) has role antibacterial agent (CHEBI:33282) |
| jadomycin B (CHEBI:31738) has role antineoplastic agent (CHEBI:35610) |
| jadomycin B (CHEBI:31738) has role apoptosis inducer (CHEBI:68495) |
| jadomycin B (CHEBI:31738) has role Aurora kinase inhibitor (CHEBI:70770) |
| jadomycin B (CHEBI:31738) has role bacterial metabolite (CHEBI:76969) |
| jadomycin B (CHEBI:31738) is a glycoside (CHEBI:24400) |
| jadomycin B (CHEBI:31738) is a jadomycin (CHEBI:48217) |
| jadomycin B (CHEBI:31738) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1S)-1-[(2S)-butan-2-yl]-7-hydroxy-5-methyl-2,8,13-trioxo-1,2,8,13-tetrahydro-3aH-benzo[b][1,3]oxazolo[3,2-f]phenanthridin-12-yl 2,6-dideoxy-α-L-ribo-hexopyranoside |
| Synonym | Source |
|---|---|
| jadomycin B | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9745667 | Reaxys |
| CAS:149633-99-8 | KEGG COMPOUND |
| CAS:149633-99-8 | ChemIDplus |
| Citations |
|---|