EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO3.HCl |
| Net Charge | 0 |
| Average Mass | 337.847 |
| Monoisotopic Mass | 337.14447 |
| SMILES | CC(COc1ccccc1)NC(C)C(O)c1ccc(O)cc1.Cl |
| InChI | InChI=1S/C18H23NO3.ClH/c1-13(12-22-17-6-4-3-5-7-17)19-14(2)18(21)15-8-10-16(20)11-9-15;/h3-11,13-14,18-21H,12H2,1-2H3;1H |
| InChIKey | QVPSGVSNYPRFAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Application: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoxsuprine hydrochloride (CHEBI:31735) has role immunosuppressive agent (CHEBI:35705) |
| Isoxsuprine hydrochloride (CHEBI:31735) is a alkylbenzene (CHEBI:38976) |
| Synonyms | Source |
|---|---|
| Duviculine | ChEMBL |
| Isoxsuprine hydrochloride | KEGG COMPOUND |
| Navilox | ChEMBL |
| NSC-757067 | ChEMBL |
| Suprilent | ChEMBL |
| Vasotran | ChEMBL |
| Brand Names | Source |
|---|---|
| Defencin | ChEMBL |
| Duvadilan ret | ChEMBL |
| Vasodilan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01748 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:579-56-6 | KEGG COMPOUND |
| Citations |
|---|