EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24I3N3O9 |
| Net Charge | 0 |
| Average Mass | 807.114 |
| Monoisotopic Mass | 806.86467 |
| SMILES | O=C(NCC(O)CO)c1c(I)c(C(=O)NCC(O)CO)c(I)c(N(CCO)C(=O)CO)c1I |
| InChI | InChI=1S/C18H24I3N3O9/c19-13-11(17(32)22-3-8(29)5-26)14(20)16(24(1-2-25)10(31)7-28)15(21)12(13)18(33)23-4-9(30)6-27/h8-9,25-30H,1-7H2,(H,22,32)(H,23,33) |
| InChIKey | AMDBBAQNWSUWGN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ioversol (CHEBI:31717) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| Ioversol | KEGG COMPOUND |
| joversol | DrugCentral |
| MP-328 | DrugCentral |
| Optiray (TN) | KEGG COMPOUND |