EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9I3N2O4.C7H17NO5 |
| Net Charge | 0 |
| Average Mass | 809.130 |
| Monoisotopic Mass | 808.88032 |
| SMILES | CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H9I3N2O4.C7H17NO5/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-2H3,(H,15,18)(H,16,17)(H,19,20);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | VLHUSFYMPUDOEL-WZTVWXICSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iothalamate meglumine (CHEBI:31714) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| Conray (TN) | KEGG COMPOUND |
| Iothalamate meglumine | KEGG COMPOUND |
| Meglumine iothalamate | KEGG COMPOUND |
| Methylglucamine iotalamate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01999 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:13087-53-1 | KEGG COMPOUND |