EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22I3N3O8 |
| Net Charge | 0 |
| Average Mass | 777.088 |
| Monoisotopic Mass | 776.85411 |
| SMILES | C[C@H](O)C(=O)Nc1c(I)c(C(=O)NC(CO)CO)c(I)c(C(=O)NC(CO)CO)c1I |
| InChI | InChI=1S/C17H22I3N3O8/c1-6(28)15(29)23-14-12(19)9(16(30)21-7(2-24)3-25)11(18)10(13(14)20)17(31)22-8(4-26)5-27/h6-8,24-28H,2-5H2,1H3,(H,21,30)(H,22,31)(H,23,29)/t6-/m0/s1 |
| InChIKey | XQZXYNRDCRIARQ-LURJTMIESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iopamidol (CHEBI:31711) has role antineoplastic agent (CHEBI:35610) |
| iopamidol (CHEBI:31711) has role environmental contaminant (CHEBI:78298) |
| iopamidol (CHEBI:31711) has role radioopaque medium (CHEBI:37338) |
| iopamidol (CHEBI:31711) has role xenobiotic (CHEBI:35703) |
| iopamidol (CHEBI:31711) is a benzenedicarboxamide (CHEBI:38800) |
| iopamidol (CHEBI:31711) is a organoiodine compound (CHEBI:37142) |
| iopamidol (CHEBI:31711) is a pentol (CHEBI:37205) |
| IUPAC Name |
|---|
| N,N'-bis(1,3-dihydroxypropan-2-yl)-5-{[(2S)-2-hydroxypropanoyl]amino}-2,4,6-triiodobenzene-1,3-dicarboxamide |
| INNs | Source |
|---|---|
| iopamidol | WHO MedNet |
| iopamidol | WHO MedNet |
| iopamidol | ChemIDplus |
| iopamidolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| L-5alpha-Hydroxypropionylamino-2,4,6-triiodoisophthalic acid di(1,3-dihydroxy-2-propylamide) | ChemIDplus |
| L-(+)-N,N'-Bis(2-hydroxy-1-hydroxymethylethyl)-2,4,6-triiodo-5-lactamide isophthalamide | ChemIDplus |
| (S)-N,N'-bis(2-Hydroxy-1-(hydroxymethyl)ethyl)-2,4,6-triiodo-5-lactamidoisophthalamide | ChemIDplus |
| SQ 13,396 | ChEMBL |
| SQ-13396 | ChEMBL |
| Brand Names | Source |
|---|---|
| Iopamidol-200 | ChEMBL |
| Iopamidol-250 | ChEMBL |
| Iopamidol-300 | ChEMBL |
| Iopamidol-370 | ChEMBL |
| Isovue | ChEMBL |
| Isovue-128 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6250226 | Reaxys |
| CAS:60166-93-0 | ChemIDplus |
| CAS:60166-93-0 | KEGG DRUG |
| Citations |
|---|