EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22I3N3O8 |
| Net Charge | 0 |
| Average Mass | 777.088 |
| Monoisotopic Mass | 776.85411 |
| SMILES | CN(C(=O)CO)c1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C17H22I3N3O8/c1-23(9(29)6-26)15-13(19)10(16(30)21-2-7(27)4-24)12(18)11(14(15)20)17(31)22-3-8(28)5-25/h7-8,24-28H,2-6H2,1H3,(H,21,30)(H,22,31) |
| InChIKey | NJKDOADNQSYQEV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. diagnostic imaging agent A substance administered to enhance contrast in images of the inside of the body obtained using X-rays, γ-rays, sound waves, radio waves (MRI), or radioactive particles in order to diagnose disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iomeprol (CHEBI:31710) has role diagnostic imaging agent (CHEBI:37334) |
| iomeprol (CHEBI:31710) has role environmental contaminant (CHEBI:78298) |
| iomeprol (CHEBI:31710) has role radioopaque medium (CHEBI:37338) |
| iomeprol (CHEBI:31710) has role xenobiotic (CHEBI:35703) |
| iomeprol (CHEBI:31710) is a benzenedicarboxamide (CHEBI:38800) |
| iomeprol (CHEBI:31710) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| N,N'-bis(2,3-dihydroxypropyl)-5-[glycoloyl(methyl)amino]-2,4,6-triiodoisophthalamide |
| INNs | Source |
|---|---|
| iomeprol | KEGG DRUG |
| iomeprolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| E-7337 | ChEMBL |
| E7337 | ChEMBL |
| Iomeron 300 | ChEMBL |
| N,N'-Bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(N-methylglycolamido)isophthalamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Iomervu | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8177227 | Reaxys |
| CAS:78649-41-9 | ChemIDplus |
| CAS:78649-41-9 | KEGG DRUG |
| Citations |
|---|