EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26I3N3O9 |
| Net Charge | 0 |
| Average Mass | 821.141 |
| Monoisotopic Mass | 820.88032 |
| SMILES | CC(=O)N(CC(O)CO)c1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C19H26I3N3O9/c1-8(29)25(4-11(32)7-28)17-15(21)12(18(33)23-2-9(30)5-26)14(20)13(16(17)22)19(34)24-3-10(31)6-27/h9-11,26-28,30-32H,2-7H2,1H3,(H,23,33)(H,24,34) |
| InChIKey | NTHXOOBQLCIOLC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iohexol (CHEBI:31709) has role environmental contaminant (CHEBI:78298) |
| iohexol (CHEBI:31709) has role radioopaque medium (CHEBI:37338) |
| iohexol (CHEBI:31709) has role xenobiotic (CHEBI:35703) |
| iohexol (CHEBI:31709) is a benzenedicarboxamide (CHEBI:38800) |
| iohexol (CHEBI:31709) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 5-[acetyl(2,3-dihydroxypropyl)amino]-N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
| INNs | Source |
|---|---|
| iohexol | KEGG DRUG |
| iohexolum | ChemIDplus |
| Synonym | Source |
|---|---|
| N,N'-Bis(2,3-dihydroxypropyl)-5-(N-(2,3-dihydroxypropyl)acetamido)-2,4,6-triiodoisophthalamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2406632 | Reaxys |
| CAS:66108-95-0 | KEGG DRUG |
| CAS:66108-95-0 | ChemIDplus |
| Citations |
|---|