EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H44I6N6O15 |
| Net Charge | 0 |
| Average Mass | 1550.188 |
| Monoisotopic Mass | 1549.71330 |
| SMILES | CC(=O)N(CC(O)CN(C(C)=O)c1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I)c1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C35H44I6N6O15/c1-13(52)46(30-26(38)20(32(59)42-3-15(54)9-48)24(36)21(27(30)39)33(60)43-4-16(55)10-49)7-19(58)8-47(14(2)53)31-28(40)22(34(61)44-5-17(56)11-50)25(37)23(29(31)41)35(62)45-6-18(57)12-51/h15-19,48-51,54-58H,3-12H2,1-2H3,(H,42,59)(H,43,60)(H,44,61)(H,45,62) |
| InChIKey | NBQNWMBBSKPBAY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodixanol (CHEBI:31705) has role radioopaque medium (CHEBI:37338) |
| iodixanol (CHEBI:31705) has role renoprotective agent (CHEBI:231911) |
| iodixanol (CHEBI:31705) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 5,5'-[(2-hydroxypropane-1,3-diyl)bis(acetylimino)]bis[N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide] |
| INNs | Source |
|---|---|
| iodixanol | ChemIDplus |
| iodixanolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-5410-3A | ChEMBL |
| 2-541O-3A | ChEMBL |
| 5,5'-((2-hydroxytrimethylene)bis(acetylimino))bis(N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodoisophthalamide) | ChemIDplus |
| NSC-760069 | ChEMBL |
| Brand Names | Source |
|---|---|
| Visipaque 270 | ChEMBL |
| Visipaque 320 | ChEMBL |
| Citations |
|---|